2-(3-methoxyphenyl)-3-nitrosoimidazo[1,2-a]pyridine structure
|
Common Name | 2-(3-methoxyphenyl)-3-nitrosoimidazo[1,2-a]pyridine | ||
|---|---|---|---|---|
| CAS Number | 205655-28-3 | Molecular Weight | 253.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-methoxyphenyl)-3-nitrosoimidazo[1,2-a]pyridine |
|---|
| Molecular Formula | C14H11N3O2 |
|---|---|
| Molecular Weight | 253.25600 |
| Exact Mass | 253.08500 |
| PSA | 55.96000 |
| LogP | 3.40780 |
| InChIKey | ORRJDFODFOSXPD-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2nc3ccccn3c2N=O)c1 |
|
~70%
2-(3-methoxyphe... CAS#:205655-28-3 |
| Literature: Srivastava, Pratima; Pandey, Vikash Chandra; Misra, Anju Prabha; Gupta, Preeti; Raj, Kanwal; Bhaduri, Amiya Prasad Bioorganic and Medicinal Chemistry, 1998 , vol. 6, # 2 p. 181 - 187 |
|
~%
2-(3-methoxyphe... CAS#:205655-28-3 |
| Literature: Srivastava, Pratima; Pandey, Vikash Chandra; Misra, Anju Prabha; Gupta, Preeti; Raj, Kanwal; Bhaduri, Amiya Prasad Bioorganic and Medicinal Chemistry, 1998 , vol. 6, # 2 p. 181 - 187 |
|
~%
2-(3-methoxyphe... CAS#:205655-28-3 |
| Literature: Srivastava, Pratima; Pandey, Vikash Chandra; Misra, Anju Prabha; Gupta, Preeti; Raj, Kanwal; Bhaduri, Amiya Prasad Bioorganic and Medicinal Chemistry, 1998 , vol. 6, # 2 p. 181 - 187 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |