tert-Butyl methyl(6-methylpyridin-2-yl)carbamate structure
|
Common Name | tert-Butyl methyl(6-methylpyridin-2-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 205676-84-2 | Molecular Weight | 208.25700 | |
| Density | 1.108g/cm3 | Boiling Point | 261.4ºC at 760 mmHg | |
| Molecular Formula | C11H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111.9ºC | |
| Name | tert-butyl 6-methylpyridin-2-ylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.108g/cm3 |
|---|---|
| Boiling Point | 261.4ºC at 760 mmHg |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.25700 |
| Flash Point | 111.9ºC |
| Exact Mass | 208.12100 |
| PSA | 51.22000 |
| LogP | 2.81000 |
| Vapour Pressure | 0.0116mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | UZRQBXOOMIFFLB-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N(C)C(=O)OC(C)(C)C)n1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD08275048 |