2-chloro-N-(2-chloro-2-phenyl-ethyl)-2-phenyl-N-(sulfinylamino)ethanamine structure
|
Common Name | 2-chloro-N-(2-chloro-2-phenyl-ethyl)-2-phenyl-N-(sulfinylamino)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 20570-07-4 | Molecular Weight | 355.28200 | |
| Density | 1.27g/cm3 | Boiling Point | 463.5ºC at 760 mmHg | |
| Molecular Formula | C16H16Cl2N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.1ºC | |
| Name | 2-chloro-N-(2-chloro-2-phenylethyl)-2-phenyl-N-(sulfinylamino)ethanamine |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 463.5ºC at 760 mmHg |
| Molecular Formula | C16H16Cl2N2OS |
| Molecular Weight | 355.28200 |
| Flash Point | 234.1ºC |
| Exact Mass | 354.03600 |
| PSA | 64.76000 |
| LogP | 5.42590 |
| Vapour Pressure | 9.03E-09mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | CQMGHQNVBZBCLA-UHFFFAOYSA-N |
| SMILES | O=S=NN(CC(Cl)c1ccccc1)CC(Cl)c1ccccc1 |
|
~%
2-chloro-N-(2-c... CAS#:20570-07-4 |
| Literature: Smith,W.T.; Chen,W.Y. Journal of Medicinal Chemistry, 1968 , vol. 11, p. 504 - 505 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |