Aceticacid, 2,2-bis(2-bromo-2-propen-1-yl)hydrazide structure
|
Common Name | Aceticacid, 2,2-bis(2-bromo-2-propen-1-yl)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 20570-14-3 | Molecular Weight | 312.00200 | |
| Density | 1.642g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H12Br2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N',N'-bis(2-bromoprop-2-enyl)acetohydrazide |
|---|
| Density | 1.642g/cm3 |
|---|---|
| Molecular Formula | C8H12Br2N2O |
| Molecular Weight | 312.00200 |
| Exact Mass | 309.93200 |
| PSA | 32.34000 |
| LogP | 2.54760 |
| Index of Refraction | 1.556 |
| InChIKey | WNLAISHYUGRXCX-UHFFFAOYSA-N |
| SMILES | C=C(Br)CN(CC(=C)Br)NC(C)=O |
|
~%
Aceticacid, 2,2... CAS#:20570-14-3 |
| Literature: Smith,W.T.; Chen,W.Y. Journal of Medicinal Chemistry, 1968 , vol. 11, p. 504 - 505 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |