ethyl 2-cyano-5-(N-methylanilino)penta-2,4-dienoate structure
|
Common Name | ethyl 2-cyano-5-(N-methylanilino)penta-2,4-dienoate | ||
|---|---|---|---|---|
| CAS Number | 20577-25-7 | Molecular Weight | 256.30000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-cyano-5-(N-methylanilino)penta-2,4-dienoate |
|---|
| Molecular Formula | C15H16N2O2 |
|---|---|
| Molecular Weight | 256.30000 |
| Exact Mass | 256.12100 |
| PSA | 53.33000 |
| LogP | 2.64958 |
| InChIKey | ZQHYGPAVRXYONB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)=CC=CN(C)c1ccccc1 |
|
~84%
ethyl 2-cyano-5... CAS#:20577-25-7 |
| Literature: Kryshtal', G.V.; Burshtein, K.Ya.; Kul'ganek, V.V.; Yanovskaya, L.A. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1984 , vol. 33, # 11 p. 2328 - 2334 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1984 , # 11 p. 2541 - 2550 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |