4-[(4-aminoanilino)methyl]-2,6-ditert-butylphenol structure
|
Common Name | 4-[(4-aminoanilino)methyl]-2,6-ditert-butylphenol | ||
|---|---|---|---|---|
| CAS Number | 205809-24-1 | Molecular Weight | 326.47600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H30N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(4-aminoanilino)methyl]-2,6-ditert-butylphenol |
|---|
| Molecular Formula | C21H30N2O |
|---|---|
| Molecular Weight | 326.47600 |
| Exact Mass | 326.23600 |
| PSA | 58.28000 |
| LogP | 5.83570 |
| InChIKey | XTXZFKJUHWKMEW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CNc2ccc(N)cc2)cc(C(C)(C)C)c1O |
|
~77%
4-[(4-aminoanil... CAS#:205809-24-1 |
| Literature: Council of Scientific and Industrial Research Patent: US6770785 B1, 2004 ; Location in patent: Page column 6 ; |
|
~%
4-[(4-aminoanil... CAS#:205809-24-1 |
| Literature: Zhukova; Nugumanova; Cherezova; Mukmeneva Russian Journal of Applied Chemistry, 1998 , vol. 71, # 9 p. 1615 - 1618 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |