2-acetamido-4-(1H-indol-3-yl)butanoic acid structure
|
Common Name | 2-acetamido-4-(1H-indol-3-yl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 205813-00-9 | Molecular Weight | 260.28800 | |
| Density | 1.29 g/cm3 | Boiling Point | 586.9ºC at 760 mmHg | |
| Molecular Formula | C14H16N2O3 | Melting Point | 112-113ºC | |
| MSDS | N/A | Flash Point | 308.7ºC | |
| Name | 2-acetamido-4-(1H-indol-3-yl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29 g/cm3 |
|---|---|
| Boiling Point | 586.9ºC at 760 mmHg |
| Melting Point | 112-113ºC |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.28800 |
| Flash Point | 308.7ºC |
| Exact Mass | 260.11600 |
| PSA | 82.19000 |
| LogP | 2.08070 |
| InChIKey | TZVGIHUGMJIKMD-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CCc1c[nH]c2ccccc12)C(=O)O |
| HS Code | 2933990090 |
|---|
|
~%
2-acetamido-4-(... CAS#:205813-00-9 |
| Literature: Journal of the American Chemical Society, , vol. 70, p. 1962 |
|
~%
2-acetamido-4-(... CAS#:205813-00-9 |
| Literature: Journal of the American Chemical Society, , vol. 70, p. 1962 |
|
~%
2-acetamido-4-(... CAS#:205813-00-9 |
| Literature: Journal of the American Chemical Society, , vol. 70, p. 1962 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Acetylamino-4-indol-3-yl-buttersaeure |
| 2-acetylamino-4-indol-3-yl-butyric acid |
| N-Acetyl-D,L-homotryptophan |