Benzeneacetamide, 3-fluoro-N-[[3-hydroxy-1-(2-pyrimidinyl)-3-piperidinyl]methyl]-N-methyl structure
|
Common Name | Benzeneacetamide, 3-fluoro-N-[[3-hydroxy-1-(2-pyrimidinyl)-3-piperidinyl]methyl]-N-methyl | ||
|---|---|---|---|---|
| CAS Number | 2058260-86-7 | Molecular Weight | 358.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H23FN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzeneacetamide, 3-fluoro-N-[[3-hydroxy-1-(2-pyrimidinyl)-3-piperidinyl]methyl]-N-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H23FN4O2 |
|---|---|
| Molecular Weight | 358.4 |
| InChIKey | VDBJQPQREVTKLI-UHFFFAOYSA-N |
| SMILES | CN(CC1(O)CCCN(c2ncccn2)C1)C(=O)Cc1cccc(F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Benzeneacetamide, 3-fluoro-N-[[3-hydroxy-1-(2-pyrimidinyl)-3-piperidinyl]methyl]-N-methyl? |
| A: Molecular formula of Benzeneacetamide, 3-fluoro-N-[[3-hydroxy-1-(2-pyrimidinyl)-3-piperidinyl]methyl]-N-methyl is C19H23FN4O2. |
| Q: What is the Chinese name of 2058260-86-7? |
| A: Chinese name of 2058260-86-7 is 2058260-86-7. |
| Q: What is the English name of Benzeneacetamide, 3-fluoro-N-[[3-hydroxy-1-(2-pyrimidinyl)-3-piperidinyl]methyl]-N-methyl? |
| A: The English name of Benzeneacetamide, 3-fluoro-N-[[3-hydroxy-1-(2-pyrimidinyl)-3-piperidinyl]methyl]-N-methyl is Benzeneacetamide, 3-fluoro-N-[[3-hydroxy-1-(2-pyrimidinyl)-3-piperidinyl]methyl]-N-methyl. |
| Q: What is the SMILES notation of Benzeneacetamide, 3-fluoro-N-[[3-hydroxy-1-(2-pyrimidinyl)-3-piperidinyl]methyl]-N-methyl? |
| A: SMILES notation of Benzeneacetamide, 3-fluoro-N-[[3-hydroxy-1-(2-pyrimidinyl)-3-piperidinyl]methyl]-N-methyl is CN(CC1(O)CCCN(c2ncccn2)C1)C(=O)Cc1cccc(F)c1. |
| Q: What is the InChIKey of Benzeneacetamide, 3-fluoro-N-[[3-hydroxy-1-(2-pyrimidinyl)-3-piperidinyl]methyl]-N-methyl? |
| A: InChIKey of Benzeneacetamide, 3-fluoro-N-[[3-hydroxy-1-(2-pyrimidinyl)-3-piperidinyl]methyl]-N-methyl is VDBJQPQREVTKLI-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Benzeneacetamide, 3-fluoro-N-[[3-hydroxy-1-(2-pyrimidinyl)-3-piperidinyl]methyl]-N-methyl? |
| A: Molecular weight of Benzeneacetamide, 3-fluoro-N-[[3-hydroxy-1-(2-pyrimidinyl)-3-piperidinyl]methyl]-N-methyl is 358.4. |
| Q: What is the CAS number of Benzeneacetamide, 3-fluoro-N-[[3-hydroxy-1-(2-pyrimidinyl)-3-piperidinyl]methyl]-N-methyl? |
| A: CAS number of Benzeneacetamide, 3-fluoro-N-[[3-hydroxy-1-(2-pyrimidinyl)-3-piperidinyl]methyl]-N-methyl is 2058260-86-7. |