Thiourea,N,N'-bis(4-bromophenyl)- structure
|
Common Name | Thiourea,N,N'-bis(4-bromophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 2059-75-8 | Molecular Weight | 386.10500 | |
| Density | 1.837g/cm3 | Boiling Point | 430.1ºC at 760 mmHg | |
| Molecular Formula | C13H10Br2N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.9ºC | |
| Name | 1,3-bis(4-bromophenyl)thiourea |
|---|
| Density | 1.837g/cm3 |
|---|---|
| Boiling Point | 430.1ºC at 760 mmHg |
| Molecular Formula | C13H10Br2N2S |
| Molecular Weight | 386.10500 |
| Flash Point | 213.9ºC |
| Exact Mass | 383.89300 |
| PSA | 56.15000 |
| LogP | 5.16650 |
| Vapour Pressure | 1.33E-07mmHg at 25°C |
| Index of Refraction | 1.774 |
| InChIKey | RQVXFYAPGIMASB-UHFFFAOYSA-N |
| SMILES | S=C(Nc1ccc(Br)cc1)Nc1ccc(Br)cc1 |
|
~80%
Thiourea,N,N'-b... CAS#:2059-75-8 |
| Literature: Zhang, Ze; Wu, Hao-Hao; Tan, Ya-Jun RSC Advances, 2013 , vol. 3, # 38 p. 16940 - 16944 |
|
~92%
Thiourea,N,N'-b... CAS#:2059-75-8 |
| Literature: Li; Wang; Luo Synthetic Communications, 2001 , vol. 31, # 5 p. 781 - 785 |
|
~66%
Thiourea,N,N'-b... CAS#:2059-75-8 |
| Literature: Herr; Kuhler; Meckler; Opalka Synthesis, 2000 , # 11 p. 1569 - 1574 |
|
~%
Thiourea,N,N'-b... CAS#:2059-75-8 |
| Literature: Hugershoff Chemische Berichte, 1899 , vol. 32, p. 2246 |
|
~%
Thiourea,N,N'-b... CAS#:2059-75-8 |
| Literature: Dyson; George Journal of the Chemical Society, 1924 , vol. 125, p. 1704 |
| Precursor 6 | |
|---|---|
| DownStream 3 | |