(2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane
Modify Date: 2026-07-09 09:02:45
(2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane structure
|
Common Name | (2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane | ||
|---|---|---|---|---|
| CAS Number | 2059908-53-9 | Molecular Weight | 221.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12FN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12FN3O |
|---|---|
| Molecular Weight | 221.23 |
| InChIKey | QYCIRXQYAMUFDB-GXSJLCMTSA-N |
| SMILES | [N-]=[N+]=NCC1CC(c2cccc(F)c2)CO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane? |
| A: Molecular formula of (2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane is C11H12FN3O. |
| Q: What is the CAS number of (2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane? |
| A: CAS number of (2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane is 2059908-53-9. |
| Q: What is the English name of (2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane? |
| A: The English name of (2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane is (2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane. |
| Q: What is the SMILES notation of (2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane? |
| A: SMILES notation of (2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane is [N-]=[N+]=NCC1CC(c2cccc(F)c2)CO1. |
| Q: What is the InChIKey of (2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane? |
| A: InChIKey of (2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane is QYCIRXQYAMUFDB-GXSJLCMTSA-N. |
| Q: What is the molecular weight of (2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane? |
| A: Molecular weight of (2R,4R)-2-(azidomethyl)-4-(3-fluorophenyl)oxolane is 221.23. |
| Q: What is the Chinese name of 2059908-53-9? |
| A: Chinese name of 2059908-53-9 is 2059908-53-9. |