7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione
Modify Date: 2026-08-30 11:14:37
![7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione Structure](https://www.chemsrc.com/extcaspic/380/2059927-90-9.png)
7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione structure
|
Common Name | 7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione | ||
|---|---|---|---|---|
| CAS Number | 2059927-90-9 | Molecular Weight | 189.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H15NO2S |
|---|---|
| Molecular Weight | 189.28 |
| InChIKey | HNJXEQWUKXXVHL-UHFFFAOYSA-N |
| SMILES | NC1CCC2(CC1)CS(=O)(=O)C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione? |
| A: The English name of 7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione is 7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione. |
| Q: What is the CAS number of 7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione? |
| A: CAS number of 7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione is 2059927-90-9. |
| Q: What is the molecular weight of 7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione? |
| A: Molecular weight of 7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione is 189.28. |
| Q: What is the InChIKey of 7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione? |
| A: InChIKey of 7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione is HNJXEQWUKXXVHL-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2059927-90-9? |
| A: Chinese name of 2059927-90-9 is 2059927-90-9. |
| Q: What is the molecular formula of 7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione? |
| A: Molecular formula of 7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione is C8H15NO2S. |
| Q: What is the SMILES notation of 7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione? |
| A: SMILES notation of 7-Amino-2lambda6-thiaspiro[3.5]nonane-2,2-dione is NC1CCC2(CC1)CS(=O)(=O)C2. |