Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate
Modify Date: 2025-09-09 13:28:04
Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate structure
|
Common Name | Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 2059932-61-3 | Molecular Weight | 246.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14N2O3 |
|---|---|
| Molecular Weight | 246.26 |
| InChIKey | LPHPRFWRENKRAQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1c[nH]n(-c2ccccc2)c1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate? |
| A: Molecular formula of Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate is C13H14N2O3. |
| Q: What is the InChIKey of Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate? |
| A: InChIKey of Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate is LPHPRFWRENKRAQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate? |
| A: Molecular weight of Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate is 246.26. |
| Q: What is the Chinese name of 2059932-61-3? |
| A: Chinese name of 2059932-61-3 is 2059932-61-3. |
| Q: What is the SMILES notation of Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate? |
| A: SMILES notation of Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate is CCOC(=O)Cc1c[nH]n(-c2ccccc2)c1=O. |
| Q: What is the CAS number of Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate? |
| A: CAS number of Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate is 2059932-61-3. |
| Q: What is the English name of Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate? |
| A: The English name of Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate is Ethyl 2-(3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetate. |