Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate
Modify Date: 2025-09-02 12:40:17
Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate structure
|
Common Name | Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2059975-09-4 | Molecular Weight | 235.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H9NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H9NO4S2 |
|---|---|
| Molecular Weight | 235.3 |
| InChIKey | QXPYPMZZFPJRHX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1sc(S(C)(=O)=O)nc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate? |
| A: Molecular weight of Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate is 235.3. |
| Q: What is the CAS number of Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate? |
| A: CAS number of Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate is 2059975-09-4. |
| Q: What is the molecular formula of Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate? |
| A: Molecular formula of Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate is C7H9NO4S2. |
| Q: What is the English name of Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate? |
| A: The English name of Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate is Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate. |
| Q: What is the InChIKey of Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate? |
| A: InChIKey of Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate is QXPYPMZZFPJRHX-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate? |
| A: SMILES notation of Methyl 2-methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylate is COC(=O)c1sc(S(C)(=O)=O)nc1C. |
| Q: What is the Chinese name of 2059975-09-4? |
| A: Chinese name of 2059975-09-4 is 2059975-09-4. |