N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide
Modify Date: 2025-09-09 17:12:23
N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide structure
|
Common Name | N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 2059975-70-9 | Molecular Weight | 207.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H17NO2 |
|---|---|
| Molecular Weight | 207.27 |
| InChIKey | VRCGPRBSPLCGHP-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)cc(NC(=O)C(C)(C)C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide? |
| A: The English name of N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide is N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide. |
| Q: What is the molecular weight of N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide? |
| A: Molecular weight of N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide is 207.27. |
| Q: What is the Chinese name of 2059975-70-9? |
| A: Chinese name of 2059975-70-9 is 2059975-70-9. |
| Q: What is the molecular formula of N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide? |
| A: Molecular formula of N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide is C12H17NO2. |
| Q: What is the SMILES notation of N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide? |
| A: SMILES notation of N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide is Cc1cc(O)cc(NC(=O)C(C)(C)C)c1. |
| Q: What is the CAS number of N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide? |
| A: CAS number of N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide is 2059975-70-9. |
| Q: What is the InChIKey of N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide? |
| A: InChIKey of N-(3-Hydroxy-5-methylphenyl)-2,2-dimethylpropanamide is VRCGPRBSPLCGHP-UHFFFAOYSA-N. |