4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride
Modify Date: 2025-08-27 20:35:21
4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride structure
|
Common Name | 4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 2060008-48-0 | Molecular Weight | 230.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H5Cl2NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H5Cl2NO3S |
|---|---|
| Molecular Weight | 230.07 |
| InChIKey | ZRHMKJKGZVVVCZ-UHFFFAOYSA-N |
| SMILES | CCc1noc(S(=O)(=O)Cl)c1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride? |
| A: The English name of 4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride is 4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride. |
| Q: What is the SMILES notation of 4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride? |
| A: SMILES notation of 4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride is CCc1noc(S(=O)(=O)Cl)c1Cl. |
| Q: What is the molecular formula of 4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride? |
| A: Molecular formula of 4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride is C5H5Cl2NO3S. |
| Q: What is the CAS number of 4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride? |
| A: CAS number of 4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride is 2060008-48-0. |
| Q: What is the Chinese name of 2060008-48-0? |
| A: Chinese name of 2060008-48-0 is 2060008-48-0. |
| Q: What is the molecular weight of 4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride? |
| A: Molecular weight of 4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride is 230.07. |
| Q: What is the InChIKey of 4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride? |
| A: InChIKey of 4-Chloro-3-ethyl-1,2-oxazole-5-sulfonyl chloride is ZRHMKJKGZVVVCZ-UHFFFAOYSA-N. |