2,3-Dimethylquinoxaline-6,7-dicarbonitrile structure
|
Common Name | 2,3-Dimethylquinoxaline-6,7-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 2060024-47-5 | Molecular Weight | 208.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Dimethylquinoxaline-6,7-dicarbonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H8N4 |
|---|---|
| Molecular Weight | 208.22 |
| InChIKey | FWKXTXAEVHJPNQ-UHFFFAOYSA-N |
| SMILES | Cc1nc2cc(C#N)c(C#N)cc2nc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,3-Dimethylquinoxaline-6,7-dicarbonitrile? |
| A: InChIKey of 2,3-Dimethylquinoxaline-6,7-dicarbonitrile is FWKXTXAEVHJPNQ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,3-Dimethylquinoxaline-6,7-dicarbonitrile? |
| A: Molecular formula of 2,3-Dimethylquinoxaline-6,7-dicarbonitrile is C12H8N4. |
| Q: What is the molecular weight of 2,3-Dimethylquinoxaline-6,7-dicarbonitrile? |
| A: Molecular weight of 2,3-Dimethylquinoxaline-6,7-dicarbonitrile is 208.22. |
| Q: What is the Chinese name of 2060024-47-5? |
| A: Chinese name of 2060024-47-5 is 2060024-47-5. |
| Q: What is the CAS number of 2,3-Dimethylquinoxaline-6,7-dicarbonitrile? |
| A: CAS number of 2,3-Dimethylquinoxaline-6,7-dicarbonitrile is 2060024-47-5. |
| Q: What is the English name of 2,3-Dimethylquinoxaline-6,7-dicarbonitrile? |
| A: The English name of 2,3-Dimethylquinoxaline-6,7-dicarbonitrile is 2,3-Dimethylquinoxaline-6,7-dicarbonitrile. |
| Q: What is the SMILES notation of 2,3-Dimethylquinoxaline-6,7-dicarbonitrile? |
| A: SMILES notation of 2,3-Dimethylquinoxaline-6,7-dicarbonitrile is Cc1nc2cc(C#N)c(C#N)cc2nc1C. |