5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole
Modify Date: 2026-07-08 18:48:18
5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole structure
|
Common Name | 5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole | ||
|---|---|---|---|---|
| CAS Number | 2060030-26-2 | Molecular Weight | 213.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16ClNO |
|---|---|
| Molecular Weight | 213.70 |
| InChIKey | XAJRTIGURGAXHK-UHFFFAOYSA-N |
| SMILES | CC1(C)C(c2ncc(CCl)o2)C1(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole? |
| A: CAS number of 5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole is 2060030-26-2. |
| Q: What is the molecular formula of 5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole? |
| A: Molecular formula of 5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole is C11H16ClNO. |
| Q: What is the Chinese name of 2060030-26-2? |
| A: Chinese name of 2060030-26-2 is 2060030-26-2. |
| Q: What is the English name of 5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole? |
| A: The English name of 5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole is 5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole. |
| Q: What is the molecular weight of 5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole? |
| A: Molecular weight of 5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole is 213.70. |
| Q: What is the InChIKey of 5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole? |
| A: InChIKey of 5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole is XAJRTIGURGAXHK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole? |
| A: SMILES notation of 5-(Chloromethyl)-2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole is CC1(C)C(c2ncc(CCl)o2)C1(C)C. |