2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride
Modify Date: 2025-09-09 12:01:02
2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride structure
|
Common Name | 2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2060037-84-3 | Molecular Weight | 213.75 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H20ClN |
|---|---|
| Molecular Weight | 213.75 |
| InChIKey | QYEABYNDSFEDPO-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)(N)Cc1ccccc1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2060037-84-3? |
| A: Chinese name of 2060037-84-3 is 2060037-84-3. |
| Q: What is the molecular formula of 2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride? |
| A: Molecular formula of 2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride is C12H20ClN. |
| Q: What is the InChIKey of 2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride? |
| A: InChIKey of 2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride is QYEABYNDSFEDPO-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride? |
| A: CAS number of 2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride is 2060037-84-3. |
| Q: What is the English name of 2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride? |
| A: The English name of 2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride is 2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride. |
| Q: What is the molecular weight of 2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride? |
| A: Molecular weight of 2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride is 213.75. |
| Q: What is the SMILES notation of 2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride? |
| A: SMILES notation of 2,3-Dimethyl-1-phenylbutan-2-amine hydrochloride is CC(C)C(C)(N)Cc1ccccc1.Cl. |