{2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol
Modify Date: 2025-09-10 11:41:41
![{2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol Structure](https://www.chemsrc.com/extcaspic/094/2060045-63-6.png)
{2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol structure
|
Common Name | {2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol | ||
|---|---|---|---|---|
| CAS Number | 2060045-63-6 | Molecular Weight | 232.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16N2O2 |
|---|---|
| Molecular Weight | 232.28 |
| InChIKey | XETNUSNNIOSOTP-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2cccc(N(C)C)c2)oc1CO |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2060045-63-6? |
| A: Chinese name of 2060045-63-6 is 2060045-63-6. |
| Q: What is the InChIKey of {2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol? |
| A: InChIKey of {2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol is XETNUSNNIOSOTP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of {2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol? |
| A: SMILES notation of {2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol is Cc1nc(-c2cccc(N(C)C)c2)oc1CO. |
| Q: What is the molecular weight of {2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol? |
| A: Molecular weight of {2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol is 232.28. |
| Q: What is the CAS number of {2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol? |
| A: CAS number of {2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol is 2060045-63-6. |
| Q: What is the English name of {2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol? |
| A: The English name of {2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol is {2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol. |
| Q: What is the molecular formula of {2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol? |
| A: Molecular formula of {2-[3-(Dimethylamino)phenyl]-4-methyl-1,3-oxazol-5-yl}methanol is C13H16N2O2. |