4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid
Modify Date: 2026-08-16 23:08:29
4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid structure
|
Common Name | 4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2060047-52-9 | Molecular Weight | 223.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H8F3NO3 |
|---|---|
| Molecular Weight | 223.15 |
| InChIKey | XWJRBJDYAMGVNU-UHFFFAOYSA-N |
| SMILES | CCCc1nc(C(F)(F)F)oc1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid? |
| A: CAS number of 4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid is 2060047-52-9. |
| Q: What is the Chinese name of 2060047-52-9? |
| A: Chinese name of 2060047-52-9 is 2060047-52-9. |
| Q: What is the InChIKey of 4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid? |
| A: InChIKey of 4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid is XWJRBJDYAMGVNU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid? |
| A: SMILES notation of 4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid is CCCc1nc(C(F)(F)F)oc1C(=O)O. |
| Q: What is the molecular weight of 4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid? |
| A: Molecular weight of 4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid is 223.15. |
| Q: What is the molecular formula of 4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid? |
| A: Molecular formula of 4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid is C8H8F3NO3. |
| Q: What is the English name of 4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid? |
| A: The English name of 4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid is 4-Propyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid. |