4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine
Modify Date: 2025-08-26 15:28:36
![4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine Structure](https://www.chemsrc.com/extcaspic/039/2060048-90-8.png)
4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine structure
|
Common Name | 4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine | ||
|---|---|---|---|---|
| CAS Number | 2060048-90-8 | Molecular Weight | 263.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H21NO3 |
|---|---|
| Molecular Weight | 263.33 |
| InChIKey | HNYGOOUWTHVFNY-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)OCCN(C(=O)OC(C)(C)C)C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine? |
| A: Molecular formula of 4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine is C15H21NO3. |
| Q: What is the CAS number of 4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine? |
| A: CAS number of 4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine is 2060048-90-8. |
| Q: What is the SMILES notation of 4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine? |
| A: SMILES notation of 4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine is Cc1ccc2c(c1)OCCN(C(=O)OC(C)(C)C)C2. |
| Q: What is the molecular weight of 4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine? |
| A: Molecular weight of 4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine is 263.33. |
| Q: What is the InChIKey of 4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine? |
| A: InChIKey of 4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine is HNYGOOUWTHVFNY-UHFFFAOYSA-N. |
| Q: What is the English name of 4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine? |
| A: The English name of 4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine is 4-Boc-8-methyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine. |
| Q: What is the Chinese name of 2060048-90-8? |
| A: Chinese name of 2060048-90-8 is 2060048-90-8. |