1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl fluoride structure
|
Common Name | 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 2060058-80-0 | Molecular Weight | 208.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H5FN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H5FN2O4S |
|---|---|
| Molecular Weight | 208.17 |
| InChIKey | CMXBUHSHSBJFQI-UHFFFAOYSA-N |
| SMILES | Cn1cc(S(=O)(=O)F)c(=O)[nH]c1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl fluoride? |
| A: SMILES notation of 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl fluoride is Cn1cc(S(=O)(=O)F)c(=O)[nH]c1=O. |
| Q: What is the InChIKey of 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl fluoride? |
| A: InChIKey of 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl fluoride is CMXBUHSHSBJFQI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2060058-80-0? |
| A: Chinese name of 2060058-80-0 is 2060058-80-0. |
| Q: What is the molecular formula of 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl fluoride? |
| A: Molecular formula of 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl fluoride is C5H5FN2O4S. |
| Q: What is the CAS number of 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl fluoride? |
| A: CAS number of 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl fluoride is 2060058-80-0. |
| Q: What is the molecular weight of 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl fluoride? |
| A: Molecular weight of 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl fluoride is 208.17. |
| Q: What is the English name of 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl fluoride? |
| A: The English name of 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl fluoride is 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl fluoride. |