4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine
Modify Date: 2025-09-09 19:06:53
![4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine Structure](https://www.chemsrc.com/extcaspic/048/2060588-41-0.png)
4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine structure
|
Common Name | 4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine | ||
|---|---|---|---|---|
| CAS Number | 2060588-41-0 | Molecular Weight | 232.10 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11Cl2NO |
|---|---|
| Molecular Weight | 232.10 |
| InChIKey | AKTHLFFKMSDLGF-UHFFFAOYSA-N |
| SMILES | CCC1(C)OCc2c1cc(Cl)nc2Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine? |
| A: The English name of 4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine is 4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine. |
| Q: What is the SMILES notation of 4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine? |
| A: SMILES notation of 4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine is CCC1(C)OCc2c1cc(Cl)nc2Cl. |
| Q: What is the molecular formula of 4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine? |
| A: Molecular formula of 4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine is C10H11Cl2NO. |
| Q: What is the molecular weight of 4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine? |
| A: Molecular weight of 4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine is 232.10. |
| Q: What is the CAS number of 4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine? |
| A: CAS number of 4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine is 2060588-41-0. |
| Q: What is the InChIKey of 4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine? |
| A: InChIKey of 4,6-Dichloro-1-ethyl-1,3-dihydro-1-methylfuro[3,4-c]pyridine is AKTHLFFKMSDLGF-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2060588-41-0? |
| A: Chinese name of 2060588-41-0 is 2060588-41-0. |