6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol
Modify Date: 2026-07-02 09:39:27
![6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol Structure](https://www.chemsrc.com/extcaspic/113/2060588-57-8.png)
6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol structure
|
Common Name | 6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol | ||
|---|---|---|---|---|
| CAS Number | 2060588-57-8 | Molecular Weight | 199.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10ClNO2 |
|---|---|
| Molecular Weight | 199.63 |
| InChIKey | XQXWYACRAPINSU-UHFFFAOYSA-N |
| SMILES | CC1(C)OC(O)c2cnc(Cl)cc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2060588-57-8? |
| A: Chinese name of 2060588-57-8 is 2060588-57-8. |
| Q: What is the InChIKey of 6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol? |
| A: InChIKey of 6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol is XQXWYACRAPINSU-UHFFFAOYSA-N. |
| Q: What is the English name of 6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol? |
| A: The English name of 6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol is 6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol. |
| Q: What is the CAS number of 6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol? |
| A: CAS number of 6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol is 2060588-57-8. |
| Q: What is the SMILES notation of 6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol? |
| A: SMILES notation of 6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol is CC1(C)OC(O)c2cnc(Cl)cc21. |
| Q: What is the molecular formula of 6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol? |
| A: Molecular formula of 6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol is C9H10ClNO2. |
| Q: What is the molecular weight of 6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol? |
| A: Molecular weight of 6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol is 199.63. |