8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile
Modify Date: 2025-09-09 16:07:33
![8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile Structure](https://www.chemsrc.com/extcaspic/251/2060594-60-5.png)
8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile structure
|
Common Name | 8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 2060594-60-5 | Molecular Weight | 220.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H8N4 |
|---|---|
| Molecular Weight | 220.23 |
| InChIKey | KAUXGOPCJLXXNE-UHFFFAOYSA-N |
| SMILES | N#Cc1nc2c(-c3ccccc3)cccn2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile? |
| A: The English name of 8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile is 8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile. |
| Q: What is the InChIKey of 8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile? |
| A: InChIKey of 8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile is KAUXGOPCJLXXNE-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile? |
| A: Molecular formula of 8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile is C13H8N4. |
| Q: What is the SMILES notation of 8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile? |
| A: SMILES notation of 8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile is N#Cc1nc2c(-c3ccccc3)cccn2n1. |
| Q: What is the molecular weight of 8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile? |
| A: Molecular weight of 8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile is 220.23. |
| Q: What is the Chinese name of 2060594-60-5? |
| A: Chinese name of 2060594-60-5 is 2060594-60-5. |
| Q: What is the CAS number of 8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile? |
| A: CAS number of 8-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile is 2060594-60-5. |