tert-butyl N-(2-hydroxy-2,3-dimethylpentyl)carbamate structure
|
Common Name | tert-butyl N-(2-hydroxy-2,3-dimethylpentyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 2061852-35-3 | Molecular Weight | 231.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-(2-hydroxy-2,3-dimethylpentyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H25NO3 |
|---|---|
| Molecular Weight | 231.33 |
| InChIKey | GFCHHSFXXGODLX-UHFFFAOYSA-N |
| SMILES | CCC(C)C(C)(O)CNC(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of tert-butyl N-(2-hydroxy-2,3-dimethylpentyl)carbamate? |
| A: Molecular formula of tert-butyl N-(2-hydroxy-2,3-dimethylpentyl)carbamate is C12H25NO3. |
| Q: What is the Chinese name of 2061852-35-3? |
| A: Chinese name of 2061852-35-3 is 2061852-35-3. |
| Q: What is the CAS number of tert-butyl N-(2-hydroxy-2,3-dimethylpentyl)carbamate? |
| A: CAS number of tert-butyl N-(2-hydroxy-2,3-dimethylpentyl)carbamate is 2061852-35-3. |
| Q: What is the molecular weight of tert-butyl N-(2-hydroxy-2,3-dimethylpentyl)carbamate? |
| A: Molecular weight of tert-butyl N-(2-hydroxy-2,3-dimethylpentyl)carbamate is 231.33. |
| Q: What is the English name of tert-butyl N-(2-hydroxy-2,3-dimethylpentyl)carbamate? |
| A: The English name of tert-butyl N-(2-hydroxy-2,3-dimethylpentyl)carbamate is tert-butyl N-(2-hydroxy-2,3-dimethylpentyl)carbamate. |
| Q: What is the SMILES notation of tert-butyl N-(2-hydroxy-2,3-dimethylpentyl)carbamate? |
| A: SMILES notation of tert-butyl N-(2-hydroxy-2,3-dimethylpentyl)carbamate is CCC(C)C(C)(O)CNC(=O)OC(C)(C)C. |
| Q: What is the InChIKey of tert-butyl N-(2-hydroxy-2,3-dimethylpentyl)carbamate? |
| A: InChIKey of tert-butyl N-(2-hydroxy-2,3-dimethylpentyl)carbamate is GFCHHSFXXGODLX-UHFFFAOYSA-N. |