6,6'-DICHLORO-3,3'-BIPYRIDINE structure
|
Common Name | 6,6'-DICHLORO-3,3'-BIPYRIDINE | ||
|---|---|---|---|---|
| CAS Number | 206438-08-6 | Molecular Weight | 225.07400 | |
| Density | 1.363g/cm3 | Boiling Point | 367ºC at 760mmHg | |
| Molecular Formula | C10H6Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-5-(6-chloropyridin-3-yl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.363g/cm3 |
|---|---|
| Boiling Point | 367ºC at 760mmHg |
| Molecular Formula | C10H6Cl2N2 |
| Molecular Weight | 225.07400 |
| Exact Mass | 223.99100 |
| PSA | 25.78000 |
| LogP | 3.45040 |
| Vapour Pressure | 2.96E-05mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | XKIAROROTBNXKZ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2ccc(Cl)nc2)cn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,3'-Bipyridine,6,6'-dichloro |
| 6,6′-Dichloro-3,3′-bipyridine |
| 6,6'-Dichloro-3,3'-bipyridine |