N-[3-(Dimethylamino)propyl]-N-[4-butoxy-2,6-dimethylphenyl]-3-phenylpropenamide structure
|
Common Name | N-[3-(Dimethylamino)propyl]-N-[4-butoxy-2,6-dimethylphenyl]-3-phenylpropenamide | ||
|---|---|---|---|---|
| CAS Number | 20682-48-8 | Molecular Weight | 408.57600 | |
| Density | 1.049g/cm3 | Boiling Point | 537.1ºC at 760 mmHg | |
| Molecular Formula | C26H36N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.6ºC | |
| Name | N-(4-butoxy-2,6-dimethylphenyl)-N-[3-(dimethylamino)propyl]-3-phenylprop-2-enamide |
|---|
| Density | 1.049g/cm3 |
|---|---|
| Boiling Point | 537.1ºC at 760 mmHg |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.57600 |
| Flash Point | 278.6ºC |
| Exact Mass | 408.27800 |
| PSA | 32.78000 |
| LogP | 5.48040 |
| Vapour Pressure | 1.32E-11mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | VJMKZEIQRKGFSK-CCEZHUSRSA-N |
| SMILES | CCCCOc1cc(C)c(N(CCCN(C)C)C(=O)C=Cc2ccccc2)c(C)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |