2,3,4,5,6-Pentafluorophenyl 4-methylbenzenesulfonate structure
|
Common Name | 2,3,4,5,6-Pentafluorophenyl 4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 2069-36-5 | Molecular Weight | 338.25000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7F5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,4,5,6-Pentafluorophenyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H7F5O3S |
|---|---|
| Molecular Weight | 338.25000 |
| Exact Mass | 338.00400 |
| PSA | 51.75000 |
| LogP | 4.53900 |
| InChIKey | IMTDUXYMXVJZPD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(F)c(F)c(F)c(F)c2F)cc1 |
| HS Code | 2906299090 |
|---|
|
~93%
2,3,4,5,6-Penta... CAS#:2069-36-5 |
| Literature: Caddick, Stephen; Wilden, Jonathan D.; Judd, Duncan B. Journal of the American Chemical Society, 2004 , vol. 126, # 4 p. 1024 - 1025 |
|
~%
2,3,4,5,6-Penta... CAS#:2069-36-5 |
| Literature: Forbes et al. Journal of the Chemical Society, 1959 , p. 2019 |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Toluol-4-sulfonsaeure-pentafluorphenylester |
| pentafluorophenyl palmitate |
| toluene-4-sulfonic acid pentafluorophenyl ester |
| pentafluorophenyl hexadecanoate |
| Hexadecanoic acid,pentafluorophenyl ester |
| pentafluorophenyl tosylate |
| palmitic acid pentafluorophenyl ester |
| pentafluorophenyl-p-toluenesulfonate |