U1Dmn1EU6W
Modify Date: 2026-07-03 20:28:39
U1Dmn1EU6W structure
|
Common Name | U1Dmn1EU6W | ||
|---|---|---|---|---|
| CAS Number | 2069950-14-5 | Molecular Weight | 417.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H16ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | U1Dmn1EU6W |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H16ClN3O3 |
|---|---|
| Molecular Weight | 417.8 |
| InChIKey | WCXAUCDLLSWGQS-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccnc1)c1ccc(CNC2=C(Cl)C(=O)c3ccccc3C2=O)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antiproliferative activity against human MDA-MB-231 cells incubated for 48 hrs by SRB...
Source: ChEMBL
Target: MDA-MB-231
External Id: CHEMBL4133894
|
|
Name: Antiproliferative activity against human HCT116 cells incubated for 48 hrs by SRB ass...
Source: ChEMBL
Target: HCT-116
External Id: CHEMBL4133893
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2069950-14-5? |
| A: Chinese name of 2069950-14-5 is 2069950-14-5. |
| Q: What is the InChIKey of U1Dmn1EU6W? |
| A: InChIKey of U1Dmn1EU6W is WCXAUCDLLSWGQS-UHFFFAOYSA-N. |
| Q: What is the CAS number of U1Dmn1EU6W? |
| A: CAS number of U1Dmn1EU6W is 2069950-14-5. |
| Q: What is the English name of U1Dmn1EU6W? |
| A: The English name of U1Dmn1EU6W is U1Dmn1EU6W. |
| Q: What is the molecular formula of U1Dmn1EU6W? |
| A: Molecular formula of U1Dmn1EU6W is C23H16ClN3O3. |
| Q: What is the molecular weight of U1Dmn1EU6W? |
| A: Molecular weight of U1Dmn1EU6W is 417.8. |
| Q: What is the SMILES notation of U1Dmn1EU6W? |
| A: SMILES notation of U1Dmn1EU6W is O=C(Nc1cccnc1)c1ccc(CNC2=C(Cl)C(=O)c3ccccc3C2=O)cc1. |