3-(4-Aminocarbonylphenyl)benzoic acid
Modify Date: 2026-07-31 23:14:41
3-(4-Aminocarbonylphenyl)benzoic acid structure
|
Common Name | 3-(4-Aminocarbonylphenyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2069998-64-5 | Molecular Weight | 241.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-Aminocarbonylphenyl)benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H11NO3 |
|---|---|
| Molecular Weight | 241.24 |
| InChIKey | NZYMBNSXWYJPEG-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc(-c2cccc(C(=O)O)c2)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of bacterial beta-lactamase OXA-48 expressed in Escherichia coli strain BL...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4147112
|
|
Name: Binding affinity to bacterial His-tagged beta-lactamase OXA-48 expressed in Escherich...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4147113
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-(4-Aminocarbonylphenyl)benzoic acid? |
| A: Molecular weight of 3-(4-Aminocarbonylphenyl)benzoic acid is 241.24. |
| Q: What is the Chinese name of 2069998-64-5? |
| A: Chinese name of 2069998-64-5 is 2069998-64-5. |
| Q: What is the SMILES notation of 3-(4-Aminocarbonylphenyl)benzoic acid? |
| A: SMILES notation of 3-(4-Aminocarbonylphenyl)benzoic acid is NC(=O)c1ccc(-c2cccc(C(=O)O)c2)cc1. |
| Q: What is the molecular formula of 3-(4-Aminocarbonylphenyl)benzoic acid? |
| A: Molecular formula of 3-(4-Aminocarbonylphenyl)benzoic acid is C14H11NO3. |
| Q: What is the InChIKey of 3-(4-Aminocarbonylphenyl)benzoic acid? |
| A: InChIKey of 3-(4-Aminocarbonylphenyl)benzoic acid is NZYMBNSXWYJPEG-UHFFFAOYSA-N. |
| Q: What is the English name of 3-(4-Aminocarbonylphenyl)benzoic acid? |
| A: The English name of 3-(4-Aminocarbonylphenyl)benzoic acid is 3-(4-Aminocarbonylphenyl)benzoic acid. |
| Q: What is the CAS number of 3-(4-Aminocarbonylphenyl)benzoic acid? |
| A: CAS number of 3-(4-Aminocarbonylphenyl)benzoic acid is 2069998-64-5. |