(9Z)-9-Octadecenedioic acid
(9Z)-9-Octadecenedioic acid structure
|
Common Name | (9Z)-9-Octadecenedioic acid | ||
|---|---|---|---|---|
| CAS Number | 20701-68-2 | Molecular Weight | 312.444 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 426.4±20.0 °C at 760 mmHg | |
| Molecular Formula | C18H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.8±18.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (9Z)-9-Octadecenedioic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 426.4±20.0 °C at 760 mmHg |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.444 |
| Flash Point | 225.8±18.3 °C |
| Exact Mass | 312.230072 |
| PSA | 74.60000 |
| LogP | 5.59 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | SBLKVIQSIHEQOF-UPHRSURJSA-N |
| SMILES | O=C(O)CCCCCCCC=CCCCCCCCC(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2917190090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 5 | |
CAS#:25601-41-6
CAS#:1046470-12-5
CAS#:123-99-9
CAS#:1732-10-1
CAS#:61549-41-5This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (9Z)-Octadec-9-enedioic acid |
| (9Z)-9-Octadecenedioic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (9Z)-9-Octadecenedioic acid? |
| A: The English name of (9Z)-9-Octadecenedioic acid is (9Z)-9-Octadecenedioic acid. |
| Q: What is the molecular weight of (9Z)-9-Octadecenedioic acid? |
| A: Molecular weight of (9Z)-9-Octadecenedioic acid is 312.444. |
| Q: What is the InChIKey of (9Z)-9-Octadecenedioic acid? |
| A: InChIKey of (9Z)-9-Octadecenedioic acid is SBLKVIQSIHEQOF-UPHRSURJSA-N. |
| Q: What is the CAS number of (9Z)-9-Octadecenedioic acid? |
| A: CAS number of (9Z)-9-Octadecenedioic acid is 20701-68-2. |
| Q: What is the boiling point of (9Z)-9-Octadecenedioic acid? |
| A: Boiling point of (9Z)-9-Octadecenedioic acid is 426.4±20.0 °C at 760 mmHg. |
| Q: What are the downstream products of (9Z)-9-Octadecenedioic acid? |
| A: Related downstream products(CAS) of (9Z)-9-Octadecenedioic acid: 25601-41-6;1046470-12-5;123-99-9;1732-10-1;61549-41-5. |
| Q: What is the polar surface area (PSA) of (9Z)-9-Octadecenedioic acid? |
| A: Polar surface area (PSA) of (9Z)-9-Octadecenedioic acid is 74.60000. |
| Q: What is the Chinese name of 20701-68-2? |
| A: Chinese name of 20701-68-2 is 20701-68-2. |
| Q: What is the molecular formula of (9Z)-9-Octadecenedioic acid? |
| A: Molecular formula of (9Z)-9-Octadecenedioic acid is C18H32O4. |
| Q: What is the SMILES notation of (9Z)-9-Octadecenedioic acid? |
| A: SMILES notation of (9Z)-9-Octadecenedioic acid is O=C(O)CCCCCCCC=CCCCCCCCC(=O)O. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |