(9Z)-9-Octadecenedioic acid structure
|
Common Name | (9Z)-9-Octadecenedioic acid | ||
|---|---|---|---|---|
| CAS Number | 20701-68-2 | Molecular Weight | 312.444 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 426.4±20.0 °C at 760 mmHg | |
| Molecular Formula | C18H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.8±18.3 °C | |
| Name | (9Z)-9-Octadecenedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 426.4±20.0 °C at 760 mmHg |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.444 |
| Flash Point | 225.8±18.3 °C |
| Exact Mass | 312.230072 |
| PSA | 74.60000 |
| LogP | 5.59 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | SBLKVIQSIHEQOF-UPHRSURJSA-N |
| SMILES | O=C(O)CCCCCCCC=CCCCCCCCC(=O)O |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 9-Octadecenedioic acid, (9Z)- |
| (9Z)-Octadec-9-enedioic acid |
| (9Z)-9-Octadecenedioic acid |