2-(2-hydroxypropyl)-3a,4,5,6,7,7a-hexahydro-octahydro-1H-4,7-epoxyisoindole-1,3-dione structure
|
Common Name | 2-(2-hydroxypropyl)-3a,4,5,6,7,7a-hexahydro-octahydro-1H-4,7-epoxyisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 20711-66-4 | Molecular Weight | 225.24100 | |
| Density | 1.352g/cm3 | Boiling Point | 444ºC at 760 mmHg | |
| Molecular Formula | C11H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.3ºC | |
| Name | 2-(2-hydroxypropyl)-3a,4,5,6,7,7a-hexahydro-octahydro-1H-4,7-epoxyisoindole-1,3-dione |
|---|
| Density | 1.352g/cm3 |
|---|---|
| Boiling Point | 444ºC at 760 mmHg |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24100 |
| Flash Point | 222.3ºC |
| Exact Mass | 225.10000 |
| PSA | 66.84000 |
| Vapour Pressure | 9.51E-10mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | GYESKCXGLKLYHY-UHFFFAOYSA-N |
| SMILES | CC(O)CN1C(=O)C2C3CCC(O3)C2C1=O |
|
~%
2-(2-hydroxypro... CAS#:20711-66-4 |
| Literature: Gringauz,A. Journal of Medicinal Chemistry, 1968 , vol. 11, p. 611 - 612 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |