2-hydroxy-6-methyl-3-(3-methylbutan-2-yl)benzoic acid structure
|
Common Name | 2-hydroxy-6-methyl-3-(3-methylbutan-2-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 20717-17-3 | Molecular Weight | 222.28000 | |
| Density | 1.11g/cm3 | Boiling Point | 339.1ºC at 760 mmHg | |
| Molecular Formula | C13H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.1ºC | |
| Name | 2-hydroxy-6-methyl-3-(3-methylbutan-2-yl)benzoic acid |
|---|
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 339.1ºC at 760 mmHg |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28000 |
| Flash Point | 173.1ºC |
| Exact Mass | 222.12600 |
| PSA | 57.53000 |
| LogP | 3.15830 |
| Vapour Pressure | 3.65E-05mmHg at 25°C |
| Index of Refraction | 1.545 |
| InChIKey | PGRPMFNLCROCLI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C)C(C)C)c(O)c1C(=O)O |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |