2-hydroxy-6-methyl-3-(2-methylbutan-2-yl)benzoic acid structure
|
Common Name | 2-hydroxy-6-methyl-3-(2-methylbutan-2-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 20717-19-5 | Molecular Weight | 222.28000 | |
| Density | 1.112g/cm3 | Boiling Point | 334.5ºC at 760 mmHg | |
| Molecular Formula | C13H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.3ºC | |
| Name | 2-hydroxy-6-methyl-3-(2-methylbutan-2-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.112g/cm3 |
|---|---|
| Boiling Point | 334.5ºC at 760 mmHg |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28000 |
| Flash Point | 170.3ºC |
| Exact Mass | 222.12600 |
| PSA | 57.53000 |
| LogP | 3.08640 |
| Vapour Pressure | 5.02E-05mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | GTCQVVDGRZVROE-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)c1ccc(C)c(C(=O)O)c1O |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 2-Methyl-5-tert.-amylsalicylsaeure |
| 2,6-CRESOTIC ACID,3-tert-PENTYL |
| 2-Methyl-5-tert-amylsalicylic acid |
| 3-tert-Pentyl-2,6-cresotic acid |