alpha-Ethyl-4-biphenylacetic acid, thymyl ester structure
|
Common Name | alpha-Ethyl-4-biphenylacetic acid, thymyl ester | ||
|---|---|---|---|---|
| CAS Number | 20724-13-4 | Molecular Weight | 372.49900 | |
| Density | 1.054g/cm3 | Boiling Point | 498.7ºC at 760 mmHg | |
| Molecular Formula | C26H28O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.3ºC | |
| Name | (5-methyl-2-propan-2-ylphenyl) 2-(4-phenylphenyl)butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.054g/cm3 |
|---|---|
| Boiling Point | 498.7ºC at 760 mmHg |
| Molecular Formula | C26H28O2 |
| Molecular Weight | 372.49900 |
| Flash Point | 153.3ºC |
| Exact Mass | 372.20900 |
| PSA | 26.30000 |
| LogP | 6.88460 |
| Vapour Pressure | 4.44E-10mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | GNBAJEWDTRDVTA-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)Oc1cc(C)ccc1C(C)C)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2916399090 |
|---|
|
~%
alpha-Ethyl-4-b... CAS#:20724-13-4 |
| Literature: De Marchi,F. et al. Chimica Therapeutica, 1968 , vol. 3, p. 433 - 437 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| sas 552 |