2,6-dimethylphenylphthalimide structure
|
Common Name | 2,6-dimethylphenylphthalimide | ||
|---|---|---|---|---|
| CAS Number | 20730-99-8 | Molecular Weight | 251.28000 | |
| Density | 1.26g/cm3 | Boiling Point | 407.3ºC at 760mmHg | |
| Molecular Formula | C16H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.7ºC | |
| Name | 2-(2,6-dimethylphenyl)isoindole-1,3-dione |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 407.3ºC at 760mmHg |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28000 |
| Flash Point | 183.7ºC |
| Exact Mass | 251.09500 |
| PSA | 37.38000 |
| LogP | 3.16900 |
| Vapour Pressure | 7.62E-07mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | KDCNGAZTEPFIKL-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1N1C(=O)c2ccccc2C1=O |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |