8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime
Modify Date: 2025-09-12 17:41:31
8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime structure
|
Common Name | 8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime | ||
|---|---|---|---|---|
| CAS Number | 2073123-46-1 | Molecular Weight | 284.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14BrNO2 |
|---|---|
| Molecular Weight | 284.15 |
| InChIKey | FWRPHJBHZLJZOM-SDNWHVSQSA-N |
| SMILES | CON=C1CCCc2cc(OC)cc(Br)c21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime? |
| A: Molecular weight of 8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime is 284.15. |
| Q: What is the CAS number of 8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime? |
| A: CAS number of 8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime is 2073123-46-1. |
| Q: What is the InChIKey of 8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime? |
| A: InChIKey of 8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime is FWRPHJBHZLJZOM-SDNWHVSQSA-N. |
| Q: What is the Chinese name of 2073123-46-1? |
| A: Chinese name of 2073123-46-1 is 2073123-46-1. |
| Q: What is the English name of 8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime? |
| A: The English name of 8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime is 8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime. |
| Q: What is the molecular formula of 8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime? |
| A: Molecular formula of 8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime is C12H14BrNO2. |
| Q: What is the SMILES notation of 8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime? |
| A: SMILES notation of 8-Bromo-6-methoxy-3,4-dihydronaphthalen-1(2H)-one O-Methyl Oxime is CON=C1CCCc2cc(OC)cc(Br)c21. |