L-693,403 maleate structure
|
Common Name | L-693,403 maleate | ||
|---|---|---|---|---|
| CAS Number | 207455-21-8 | Molecular Weight | 393.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H27NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-693,403 maleateL-693403 maleate is a high affinity and selective σ ligand. L-693403 maleate has the potential for physiological disease research[1]. |
| Name | L-693,403 maleate |
|---|---|
| Synonym | More Synonyms |
| Description | L-693403 maleate is a high affinity and selective σ ligand. L-693403 maleate has the potential for physiological disease research[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H27NO4 |
|---|---|
| Molecular Weight | 393.48 |
| Exact Mass | 393.194000 |
| InChIKey | WAZQVIBRRAMDNX-BTJKTKAUSA-N |
| SMILES | O=C(O)C=CC(=O)O.c1ccc(CN2CCC3(CCc4ccccc43)CC2)cc1 |
| 1'-Benzyl-2,3-dihydrospiro[indene-1,4'-piperidine] (2Z)-2-butenedioate (1:1) |
| Spiro[1H-indene-1,4'-piperidine], 2,3-dihydro-1'-(phenylmethyl)-, (2Z)-2-butenedioate (1:1) |
| MFCD00673756 |
| 1'-Benzyl-2,3-dihydrospiro[indene-1,4'-piperidine] (2Z)-but-2-enedioate (1:1) |