(4S)-(-)-T-BUTYLDIMETHYLSILOXY-2-CYCLOPENTEN-1-ONE structure
|
Common Name | (4S)-(-)-T-BUTYLDIMETHYLSILOXY-2-CYCLOPENTEN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 207497-61-8 | Molecular Weight | 287.31000 | |
| Density | 1.329g/cm3 | Boiling Point | 534.9ºC at 760 mmHg | |
| Molecular Formula | C16H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.3ºC | |
| Name | (2S,4S)-2-amino-4-(naphthalen-2-ylmethyl)pentanedioic acid |
|---|
| Density | 1.329g/cm3 |
|---|---|
| Boiling Point | 534.9ºC at 760 mmHg |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31000 |
| Flash Point | 277.3ºC |
| Exact Mass | 287.11600 |
| PSA | 100.62000 |
| LogP | 2.58540 |
| Vapour Pressure | 2.85E-12mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | YDWIUFASTTZKNI-KBPBESRZSA-N |
| SMILES | NC(CC(Cc1ccc2ccccc2c1)C(=O)O)C(=O)O |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |