2,4-dimethyl-5-nitro-1,3-thiazole structure
|
Common Name | 2,4-dimethyl-5-nitro-1,3-thiazole | ||
|---|---|---|---|---|
| CAS Number | 20751-81-9 | Molecular Weight | 158.17800 | |
| Density | 1.357g/cm3 | Boiling Point | 252.3ºC at 760 mmHg | |
| Molecular Formula | C5H6N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.4ºC | |
| Name | 2,4-dimethyl-5-nitro-1,3-thiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.357g/cm3 |
|---|---|
| Boiling Point | 252.3ºC at 760 mmHg |
| Molecular Formula | C5H6N2O2S |
| Molecular Weight | 158.17800 |
| Flash Point | 106.4ºC |
| Exact Mass | 158.01500 |
| PSA | 86.95000 |
| LogP | 2.19130 |
| Vapour Pressure | 0.0309mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | BYPDKSUPMPAFPC-UHFFFAOYSA-N |
| SMILES | Cc1nc(C)c([N+](=O)[O-])s1 |
|
~%
2,4-dimethyl-5-... CAS#:20751-81-9 |
| Literature: Sytsch Ukrainskii Khimicheskii Zhurnal (Russian Edition), 1959 , vol. 25, p. 344,346 Chem.Abstr., 1960 , p. 5619 Full Text Show Details Ganapathi; Venkataraman Proceedings - Indian Academy of Sciences, Section A, 1945 , # 22 p. 362,376 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,4-Dimethyl-5-nitrothiazol |
| 2,4-dimethyl-5-nitro-thiazole |
| 5-Nitro-2,4-dimethyl-thiazol |
| 3,4-dimethyl-5-nitro-pyridine |
| 3,4-Dimethyl-5-nitro-thiazol |