2,5-Cyclohexadiene-1,4-dione,2,5-dichloro-3,6-diethoxy- structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2,5-dichloro-3,6-diethoxy- | ||
|---|---|---|---|---|
| CAS Number | 20764-96-9 | Molecular Weight | 265.09000 | |
| Density | 1.38g/cm3 | Boiling Point | 419.9ºC at 760mmHg | |
| Molecular Formula | C10H10Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182ºC | |
| Name | 2,5-Dichloro-3,6-diethoxy-1,4-benzoquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 419.9ºC at 760mmHg |
| Molecular Formula | C10H10Cl2O4 |
| Molecular Weight | 265.09000 |
| Flash Point | 182ºC |
| Exact Mass | 263.99600 |
| PSA | 52.60000 |
| LogP | 2.11200 |
| Vapour Pressure | 2.94E-07mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | IXCUULHJQDWEKS-UHFFFAOYSA-N |
| SMILES | CCOC1=C(Cl)C(=O)C(OCC)=C(Cl)C1=O |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,5-Dichlor-3,6-diaethoxybenzochinon |
| 2,5-Dichloro-3,6-diethoxy-2,5-cyclohexadiene-1,4-dione |