5-Acetamido phthalide
5-Acetamido phthalide structure
|
Common Name | 5-Acetamido phthalide | ||
|---|---|---|---|---|
| CAS Number | 207683-94-1 | Molecular Weight | 191.18300 | |
| Density | 1.373±0.06 g/cm3(Predicted) | Boiling Point | 509.9±50.0 °C(Predicted) | |
| Molecular Formula | C10H9NO3 | Melting Point | 222-223 °C | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-acetamido-phthalide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.373±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 509.9±50.0 °C(Predicted) |
| Melting Point | 222-223 °C |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.18300 |
| Exact Mass | 191.05800 |
| PSA | 55.40000 |
| LogP | 1.38840 |
| InChIKey | XBLPTNDIRVYALA-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc2c(c1)COC2=O |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-Acetylamino-phthalid |
| 5-acetamidophthalide |
| 5-acetylamino-phthalide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5-acetamido-phthalide? |
| A: CAS number of 5-acetamido-phthalide is 207683-94-1. |
| Q: What is the LogP of 5-acetamido-phthalide? |
| A: LogP of 5-acetamido-phthalide is 1.38840. |
| Q: What is the molecular formula of 5-acetamido-phthalide? |
| A: Molecular formula of 5-acetamido-phthalide is C10H9NO3. |
| Q: What is the SMILES notation of 5-acetamido-phthalide? |
| A: SMILES notation of 5-acetamido-phthalide is CC(=O)Nc1ccc2c(c1)COC2=O. |
| Q: What is the melting point of 5-acetamido-phthalide? |
| A: Melting point of 5-acetamido-phthalide is 222-223 °C. |
| Q: What is the English name of 5-acetamido-phthalide? |
| A: The English name of 5-acetamido-phthalide is 5-acetamido-phthalide. |
| Q: What is the molecular weight of 5-acetamido-phthalide? |
| A: Molecular weight of 5-acetamido-phthalide is 191.18300. |
| Q: What is the polar surface area (PSA) of 5-acetamido-phthalide? |
| A: Polar surface area (PSA) of 5-acetamido-phthalide is 55.40000. |
| Q: What English synonyms does 5-acetamido-phthalide have? |
| A: English synonyms of 5-acetamido-phthalide: 5-Acetylamino-phthalid, 5-acetamidophthalide, 5-acetylamino-phthalide. |
| Q: What is the InChIKey of 5-acetamido-phthalide? |
| A: InChIKey of 5-acetamido-phthalide is XBLPTNDIRVYALA-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |