1-(3-Nitrophenyl)-9,10-anthraquinone structure
|
Common Name | 1-(3-Nitrophenyl)-9,10-anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 20770-24-5 | Molecular Weight | 329.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3-nitrophenyl)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H11NO4 |
|---|---|
| Molecular Weight | 329.30600 |
| Exact Mass | 329.06900 |
| PSA | 79.96000 |
| LogP | 4.56040 |
| InChIKey | UUHDYJJYDHMLNE-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c1cccc2-c1cccc([N+](=O)[O-])c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(3-Nitrophenyl)anthra-9,10-quinone |
| 1-(3-Nitrophenyl)-9,10-anthraquinone |
| Anthraquinone,1-(m-nitrophenyl) |