2-carboxymethyl-5-trifluoromethyl-benzoic acid structure
|
Common Name | 2-carboxymethyl-5-trifluoromethyl-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 207804-91-9 | Molecular Weight | 248.15500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7F3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(carboxymethyl)-5-(trifluoromethyl)benzoic acid |
|---|
| Molecular Formula | C10H7F3O4 |
|---|---|
| Molecular Weight | 248.15500 |
| Exact Mass | 248.03000 |
| PSA | 74.60000 |
| LogP | 2.03070 |
| InChIKey | MGLYNUWGGMOQIN-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1ccc(C(F)(F)F)cc1C(=O)O |
|
~%
2-carboxymethyl... CAS#:207804-91-9 |
| Literature: Quallich, George J.; Makowski, Teresa W.; Sanders, Andrew F.; Urban, Frank J.; Vazquez, Enrique Journal of Organic Chemistry, 1998 , vol. 63, # 12 p. 4116 - 4119 |
|
~%
2-carboxymethyl... CAS#:207804-91-9 |
| Literature: Quallich, George J.; Makowski, Teresa W.; Sanders, Andrew F.; Urban, Frank J.; Vazquez, Enrique Journal of Organic Chemistry, 1998 , vol. 63, # 12 p. 4116 - 4119 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |