1-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]ethanone structure
|
Common Name | 1-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 207994-12-5 | Molecular Weight | 223.580 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 210.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H5ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 81.0±27.3 °C | |
| Name | 1-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 210.3±40.0 °C at 760 mmHg |
| Molecular Formula | C8H5ClF3NO |
| Molecular Weight | 223.580 |
| Flash Point | 81.0±27.3 °C |
| Exact Mass | 223.001175 |
| PSA | 29.96000 |
| LogP | 3.11 |
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | UJXXBJRNTFTYRK-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ncc(C(F)(F)F)cc1Cl |
| HS Code | 2933399090 |
|---|
|
~45%
1-[3-chloro-5-(... CAS#:207994-12-5 |
| Literature: Bayer CropScience S.A. Patent: EP1548007 A1, 2005 ; Location in patent: Page/Page column 44 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]ethanone |
| 2-acetyl-3-chloro-5-(trifluoromethyl)-pyridine |
| 3-chloro-5-trifluoromethyl-2-acetylpyridine |
| 1-(3-CHLORO-5-TRIFLUOROMETHYL-PYRIDIN-2-YL)-ETHANONE |
| Ethanone, 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]- |