Benzene,1,1'-(1-methyl-1,2-ethenediyl)bis[4-methoxy- structure
|
Common Name | Benzene,1,1'-(1-methyl-1,2-ethenediyl)bis[4-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 20802-02-2 | Molecular Weight | 254.32400 | |
| Density | 1.057g/cm3 | Boiling Point | 383.1ºC at 760mmHg | |
| Molecular Formula | C17H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.9ºC | |
| Name | 1-methoxy-4-[1-(4-methoxyphenyl)prop-1-en-2-yl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.057g/cm3 |
|---|---|
| Boiling Point | 383.1ºC at 760mmHg |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.32400 |
| Flash Point | 148.9ºC |
| Exact Mass | 254.13100 |
| PSA | 18.46000 |
| LogP | 4.26430 |
| Vapour Pressure | 9.91E-06mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | BOXKCNFVZZMEER-OUKQBFOZSA-N |
| SMILES | COc1ccc(C=C(C)c2ccc(OC)cc2)cc1 |
| HS Code | 2909309090 |
|---|
|
~%
Benzene,1,1'-(1... CAS#:20802-02-2 |
| Literature: Huang Journal of the Chemical Society, 1954 , p. 2539 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,2-Di-(p-anisyl)-propen-(1) |
| 1-Propene,1,2-bis(4-methox |
| 1,2-bis(p-methoxyphenyl)propene |