5'-Chloro-2'-[2-(diisopropylamino)ethoxy]butyrophenone structure
|
Common Name | 5'-Chloro-2'-[2-(diisopropylamino)ethoxy]butyrophenone | ||
|---|---|---|---|---|
| CAS Number | 20809-23-8 | Molecular Weight | 325.87300 | |
| Density | 1.039g/cm3 | Boiling Point | 419.5ºC at 760 mmHg | |
| Molecular Formula | C18H28ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.5ºC | |
| Name | 1-[5-chloro-2-[2-[di(propan-2-yl)amino]ethoxy]phenyl]butan-1-one |
|---|
| Density | 1.039g/cm3 |
|---|---|
| Boiling Point | 419.5ºC at 760 mmHg |
| Molecular Formula | C18H28ClNO2 |
| Molecular Weight | 325.87300 |
| Flash Point | 207.5ºC |
| Exact Mass | 325.18100 |
| PSA | 29.54000 |
| LogP | 4.82040 |
| Vapour Pressure | 3.02E-07mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | VINIHWKNHVRYQN-UHFFFAOYSA-N |
| SMILES | CCCC(=O)c1cc(Cl)ccc1OCCN(C(C)C)C(C)C |
| HS Code | 2922509090 |
|---|
|
~%
5'-Chloro-2'-[2... CAS#:20809-23-8 |
| Literature: Da Re,P. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 266 - 270 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |