tert-Butyl [(3-methyloxetan-3-yl)methyl]carbamate structure
|
Common Name | tert-Butyl [(3-methyloxetan-3-yl)methyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 208105-83-3 | Molecular Weight | 201.263 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 285.1±13.0 °C at 760 mmHg | |
| Molecular Formula | C10H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.2±19.8 °C | |
| Name | tert-butyl N-[(3-methyloxetan-3-yl)methyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 285.1±13.0 °C at 760 mmHg |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.263 |
| Flash Point | 126.2±19.8 °C |
| Exact Mass | 201.136490 |
| PSA | 47.56000 |
| LogP | 1.22 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.455 |
| InChIKey | UGBWAOZVKHUEIF-UHFFFAOYSA-N |
| SMILES | CC1(CNC(=O)OC(C)(C)C)COC1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl [(3-methyl-3-oxetanyl)methyl]carbamate |
| N-Boc-3-(aminomethyl)-3-methyloxetane |
| Carbamic acid, N-[(3-methyl-3-oxetanyl)methyl]-, 1,1-dimethylethyl ester |
| tert-Butyl [(3-methyloxetan-3-yl)methyl]carbamate |
| N-BOC-(3-METHYLOXETAN-3-YL)METHYLAMINE |