5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline
Modify Date: 2026-07-16 11:57:38
![5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline Structure](https://www.chemsrc.com/extcaspic/249/2081970-14-9.png)
5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline structure
|
Common Name | 5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline | ||
|---|---|---|---|---|
| CAS Number | 2081970-14-9 | Molecular Weight | 409.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H27N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H27N3O |
|---|---|
| Molecular Weight | 409.5 |
| InChIKey | GSKMUEWNKKRQPF-UHFFFAOYSA-N |
| SMILES | Cc1cc2nccc(-c3cccnc3)c2c(C)c1-c1ccc(CN2CCOCC2)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Kinetic solubility of the compound at pH 7.4 by chemiluminescence nitrogen detection ...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4264873
|
|
Name: Inhibition of Mycobacterium tuberculosis H37Rv FadD32 assessed as reduction in bacter...
Source: ChEMBL
Target: Long-chain-fatty-acid--AMP ligase FadD32
External Id: CHEMBL4264872
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline? |
| A: InChIKey of 5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline is GSKMUEWNKKRQPF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline? |
| A: SMILES notation of 5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline is Cc1cc2nccc(-c3cccnc3)c2c(C)c1-c1ccc(CN2CCOCC2)cc1. |
| Q: What is the CAS number of 5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline? |
| A: CAS number of 5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline is 2081970-14-9. |
| Q: What is the English name of 5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline? |
| A: The English name of 5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline is 5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline. |
| Q: What is the Chinese name of 2081970-14-9? |
| A: Chinese name of 2081970-14-9 is 2081970-14-9. |
| Q: What is the molecular weight of 5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline? |
| A: Molecular weight of 5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline is 409.5. |
| Q: What is the molecular formula of 5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline? |
| A: Molecular formula of 5,7-Dimethyl-6-[4-(4-morpholinylmethyl)phenyl]-4-(3-pyridinyl)quinoline is C27H27N3O. |